C20H19NO3S2 — CID 10500319
3-(benzenesulfonyl)-3-prop-2-enyl-10,10a-dihydro-1H-[1,4]thiazino[4,3-a]indol-4-one (PubChem CID 10500319) has the molecular formula C20H19NO3S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-3-prop-2-enyl-10,10a-dihydro-1H-[1,4]thiazino[4,3-a]indol-4-one.
| Compound Name | 3-(benzenesulfonyl)-3-prop-2-enyl-10,10a-dihydro-1H-[1,4]thiazino[4,3-a]indol-4-one |
|---|---|
| PubChem CID | 10500319 |
| Molecular Formula | C20H19NO3S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 3-(benzenesulfonyl)-3-prop-2-enyl-10,10a-dihydro-1H-[1,4]thiazino[4,3-a]indol-4-one |
| SMILES | C=CCC1(S(=O)(=O)c2ccccc2)SCC2Cc3ccccc3N2C1=O |
| InChI | InChI=1S/C20H19NO3S2/c1-2-12-20(26(23,24)17-9-4-3-5-10-17)19(22)21-16(14-25-20)13-15-8-6-7-11-18(15)21/h2-11,16H,1,12-14H2 |
| InChIKey | VRWJKPDJPAROBR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|