About cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol
cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol (PubChem CID 178185671) has the molecular formula C16H21NO
and a molecular weight of 243.35 g/mol. Its IUPAC name is cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol.
Molecular Properties
| Compound Name | cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol |
| PubChem CID | 178185671 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol |
| SMILES | C=CC[C@@]1(O)CCC[C@@H]1N1CCc2ccccc21 |
| InChI | InChI=1S/C16H21NO/c1-2-10-16(18)11-5-8-15(16)17-12-9-13-6-3-4-7-14(13)17/h2-4,6-7,15,18H,1,5,8-12H2/t15-,16+/m0/s1 |
| InChIKey | DQFNRARYNLAKNZ-JKSUJKDBSA-N |
| XLogP | 2.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol?
The IUPAC name of cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol (CID 178185671) is cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol.
What is the SMILES notation for cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol?
The canonical SMILES for cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol is C=CC[C@@]1(O)CCC[C@@H]1N1CCc2ccccc21.
What is the InChIKey of cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol?
The InChIKey is DQFNRARYNLAKNZ-JKSUJKDBSA-N. The full InChI is InChI=1S/C16H21NO/c1-2-10-16(18)11-5-8-15(16)17-12-9-13-6-3-4-7-14(13)17/h2-4,6-7,15,18H,1,5,8-12H2/t15-,16+/m0/s1.
What are the key properties of cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol?
cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol has a molecular weight of 243.35 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2S)-2-(2,3-dihydroindol-1-yl)-1-prop-2-enylcyclopentan-1-ol is sourced from PubChem (CID 178185671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).