C17H19NO2 — CID 11380195
spiro[2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,2'-cyclohexane]-1',3'-dione (PubChem CID 11380195) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is spiro[2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,2'-cyclohexane]-1',3'-dione.
| Compound Name | spiro[2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,2'-cyclohexane]-1',3'-dione |
|---|---|
| PubChem CID | 11380195 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | spiro[2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,2'-cyclohexane]-1',3'-dione |
| SMILES | O=C1CCCC(=O)C12Cc1ccccc1N1CCCC12 |
| InChI | InChI=1S/C17H19NO2/c19-15-8-3-9-16(20)17(15)11-12-5-1-2-6-13(12)18-10-4-7-14(17)18/h1-2,5-6,14H,3-4,7-11H2 |
| InChIKey | IOFJDRBXAYJPKU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|