C21H20N2O3 — CID 135031745
methyl (3aS,4S)-2'-oxospiro[2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,3'-indole]-1'-carboxylate (PubChem CID 135031745) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl (3aS,4S)-2'-oxospiro[2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,3'-indole]-1'-carboxylate.
| Compound Name | methyl (3aS,4S)-2'-oxospiro[2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,3'-indole]-1'-carboxylate |
|---|---|
| PubChem CID | 135031745 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | methyl (3aS,4S)-2'-oxospiro[2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,3'-indole]-1'-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@@]2(Cc3ccccc3N3CCC[C@H]32)c2ccccc21 |
| InChI | InChI=1S/C21H20N2O3/c1-26-20(25)23-17-10-5-3-8-15(17)21(19(23)24)13-14-7-2-4-9-16(14)22-12-6-11-18(21)22/h2-5,7-10,18H,6,11-13H2,1H3/t18-,21-/m0/s1 |
| InChIKey | LGCBVCAHYSISHM-RXVVDRJESA-N |
| XLogP | 3.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |