C21H18FN3O3 — CID 7678416
(3'aR,5S)-1-(4-fluorophenyl)spiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione (PubChem CID 7678416) has the molecular formula C21H18FN3O3 and a molecular weight of 379.39 g/mol. Its IUPAC name is (3'aR,5S)-1-(4-fluorophenyl)spiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | (3'aR,5S)-1-(4-fluorophenyl)spiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 7678416 |
| Molecular Formula | C21H18FN3O3 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | (3'aR,5S)-1-(4-fluorophenyl)spiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-2,4,6-trione |
| SMILES | O=C1NC(=O)[C@@]2(Cc3ccccc3N3CCC[C@@H]32)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H18FN3O3/c22-14-7-9-15(10-8-14)25-19(27)21(18(26)23-20(25)28)12-13-4-1-2-5-16(13)24-11-3-6-17(21)24/h1-2,4-5,7-10,17H,3,6,11-12H2,(H,23,26,28)/t17-,21+/m1/s1 |
| InChIKey | SSWBPOGUYBIMJC-UTKZUKDTSA-N |
| XLogP | 2.62 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|