C13H17NO — CID 134858745
1-[(2R)-oxan-2-yl]-2,3-dihydroindole (PubChem CID 134858745) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-[(2R)-oxan-2-yl]-2,3-dihydroindole.
| Compound Name | 1-[(2R)-oxan-2-yl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 134858745 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-[(2R)-oxan-2-yl]-2,3-dihydroindole |
| SMILES | c1ccc2c(c1)CCN2[C@H]1CCCCO1 |
| InChI | InChI=1S/C13H17NO/c1-2-6-12-11(5-1)8-9-14(12)13-7-3-4-10-15-13/h1-2,5-6,13H,3-4,7-10H2/t13-/m1/s1 |
| InChIKey | CBRWSJNUDWTLEJ-CYBMUJFWSA-N |
| XLogP | 2.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |