C12H16N2 — CID 80561205
3-(2,3-dihydroindol-1-yl)cyclobutan-1-amine (PubChem CID 80561205) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)cyclobutan-1-amine.
| Compound Name | 3-(2,3-dihydroindol-1-yl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 80561205 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)cyclobutan-1-amine |
| SMILES | NC1CC(N2CCc3ccccc32)C1 |
| InChI | InChI=1S/C12H16N2/c13-10-7-11(8-10)14-6-5-9-3-1-2-4-12(9)14/h1-4,10-11H,5-8,13H2 |
| InChIKey | WUIMNPNPFBLZKY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |