About 2,3-dihydroindol-1-amine;dihydrochloride
2,3-dihydroindol-1-amine;dihydrochloride (PubChem CID 172716948) has the molecular formula C8H12Cl2N2
and a molecular weight of 207.10 g/mol. Its IUPAC name is 2,3-dihydroindol-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | 2,3-dihydroindol-1-amine;dihydrochloride |
| PubChem CID | 172716948 |
| Molecular Formula | C8H12Cl2N2 |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2,3-dihydroindol-1-amine;dihydrochloride |
| SMILES | Cl.Cl.NN1CCc2ccccc21 |
| InChI | InChI=1S/C8H10N2.2ClH/c9-10-6-5-7-3-1-2-4-8(7)10;;/h1-4H,5-6,9H2;2*1H |
| InChIKey | FZJQOPCUPDTVDN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroindol-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroindol-1-amine;dihydrochloride?
The IUPAC name of 2,3-dihydroindol-1-amine;dihydrochloride (CID 172716948) is 2,3-dihydroindol-1-amine;dihydrochloride.
What is the SMILES notation for 2,3-dihydroindol-1-amine;dihydrochloride?
The canonical SMILES for 2,3-dihydroindol-1-amine;dihydrochloride is Cl.Cl.NN1CCc2ccccc21.
What is the InChIKey of 2,3-dihydroindol-1-amine;dihydrochloride?
The InChIKey is FZJQOPCUPDTVDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2.2ClH/c9-10-6-5-7-3-1-2-4-8(7)10;;/h1-4H,5-6,9H2;2*1H.
What are the key properties of 2,3-dihydroindol-1-amine;dihydrochloride?
2,3-dihydroindol-1-amine;dihydrochloride has a molecular weight of 207.10 g/mol, XLogP of 1.77, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroindol-1-amine;dihydrochloride is sourced from PubChem (CID 172716948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).