C8H8N4 — CID 54253401
1-azido-2,3-dihydroindole (PubChem CID 54253401) has the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. Its IUPAC name is 1-azido-2,3-dihydroindole.
| Compound Name | 1-azido-2,3-dihydroindole |
|---|---|
| PubChem CID | 54253401 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 1-azido-2,3-dihydroindole |
| SMILES | [N-]=[N+]=NN1CCc2ccccc21 |
| InChI | InChI=1S/C8H8N4/c9-10-11-12-6-5-7-3-1-2-4-8(7)12/h1-4H,5-6H2 |
| InChIKey | QYIQMZQXBIXDKM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|