C14H20N4 — CID 141240555
1-(4-azido-2,3-dimethylbutan-2-yl)-2,3-dihydroindole (PubChem CID 141240555) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 1-(4-azido-2,3-dimethylbutan-2-yl)-2,3-dihydroindole.
| Compound Name | 1-(4-azido-2,3-dimethylbutan-2-yl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 141240555 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 1-(4-azido-2,3-dimethylbutan-2-yl)-2,3-dihydroindole |
| SMILES | CC(CN=[N+]=[N-])C(C)(C)N1CCc2ccccc21 |
| InChI | InChI=1S/C14H20N4/c1-11(10-16-17-15)14(2,3)18-9-8-12-6-4-5-7-13(12)18/h4-7,11H,8-10H2,1-3H3 |
| InChIKey | FZSFFPYYYQCOKB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|