C29H51N3 — CID 165107586
1-tert-butyl-2,3-dihydroindole;2-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;1-propan-2-ylpyrrolidine (PubChem CID 165107586) has the molecular formula C29H51N3 and a molecular weight of 441.75 g/mol. Its IUPAC name is 1-tert-butyl-2,3-dihydroindole;2-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;1-propan-2-ylpyrrolidine.
| Compound Name | 1-tert-butyl-2,3-dihydroindole;2-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;1-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 165107586 |
| Molecular Formula | C29H51N3 |
| Molecular Weight | 441.75 g/mol |
| Exact Mass | 441.41 |
| IUPAC Name | 1-tert-butyl-2,3-dihydroindole;2-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole;1-propan-2-ylpyrrolidine |
| SMILES | CC(C)(C)N1CCc2ccccc21.CC(C)N1CC2CCCC2C1.CC(C)N1CCCC1 |
| InChI | InChI=1S/C12H17N.C10H19N.C7H15N/c1-12(2,3)13-9-8-10-6-4-5-7-11(10)13;1-8(2)11-6-9-4-3-5-10(9)7-11;1-7(2)8-5-3-4-6-8/h4-7H,8-9H2,1-3H3;8-10H,3-7H2,1-2H3;7H,3-6H2,1-2H3 |
| InChIKey | ZKCMTBMFELGNOU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.75 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |