C13H27N — CID 159480431
ethane;2-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 159480431) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is ethane;2-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | ethane;2-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 159480431 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | ethane;2-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CC.CC(C)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C11H21N.C2H6/c1-9(2)12-7-10-5-3-4-6-11(10)8-12;1-2/h9-11H,3-8H2,1-2H3;1-2H3 |
| InChIKey | LWXWACCPWAXTJY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |