C11H22N2 — CID 155648643
(5R)-2-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 155648643) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (5R)-2-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (5R)-2-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 155648643 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (5R)-2-propan-2-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | CC(C)N1CC2CC[C@@H](N)CC2C1 |
| InChI | InChI=1S/C11H22N2/c1-8(2)13-6-9-3-4-11(12)5-10(9)7-13/h8-11H,3-7,12H2,1-2H3/t9?,10?,11-/m1/s1 |
| InChIKey | TXLYUNDQBOIGHF-VQXHTEKXSA-N |
| XLogP | 1.45 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |