C11H21NO — CID 131167890
2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)propan-1-ol (PubChem CID 131167890) has the molecular formula C11H21NO and a molecular weight of 183.30 g/mol. Its IUPAC name is 2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)propan-1-ol.
| Compound Name | 2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 131167890 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)propan-1-ol |
| SMILES | CC(CO)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C11H21NO/c1-9(8-13)12-6-10-4-2-3-5-11(10)7-12/h9-11,13H,2-8H2,1H3 |
| InChIKey | AIJDZFDMHZCXJL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |