C28H56N4 — CID 164996340
2,6-di(propan-2-yl)-1,3,4,4a,5,7,8,8a-octahydro-2,6-naphthyridine;2,7-di(propan-2-yl)-1,3,4,4a,5,6,8,8a-octahydro-2,7-naphthyridine (PubChem CID 164996340) has the molecular formula C28H56N4 and a molecular weight of 448.78 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)-1,3,4,4a,5,7,8,8a-octahydro-2,6-naphthyridine;2,7-di(propan-2-yl)-1,3,4,4a,5,6,8,8a-octahydro-2,7-naphthyridine.
| Compound Name | 2,6-di(propan-2-yl)-1,3,4,4a,5,7,8,8a-octahydro-2,6-naphthyridine;2,7-di(propan-2-yl)-1,3,4,4a,5,6,8,8a-octahydro-2,7-naphthyridine |
|---|---|
| PubChem CID | 164996340 |
| Molecular Formula | C28H56N4 |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 448.45 |
| IUPAC Name | 2,6-di(propan-2-yl)-1,3,4,4a,5,7,8,8a-octahydro-2,6-naphthyridine;2,7-di(propan-2-yl)-1,3,4,4a,5,6,8,8a-octahydro-2,7-naphthyridine |
| SMILES | CC(C)N1CCC2CCN(C(C)C)CC2C1.CC(C)N1CCC2CN(C(C)C)CCC2C1 |
| InChI | InChI=1S/2C14H28N2/c1-11(2)15-7-5-14-10-16(12(3)4)8-6-13(14)9-15;1-11(2)15-7-5-13-6-8-16(12(3)4)10-14(13)9-15/h2*11-14H,5-10H2,1-4H3 |
| InChIKey | HPLYUHUOEADDSG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |