C11H22N2Te — CID 171800016
2-methyltellanyl-5-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine (PubChem CID 171800016) has the molecular formula C11H22N2Te and a molecular weight of 309.91 g/mol. Its IUPAC name is 2-methyltellanyl-5-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine.
| Compound Name | 2-methyltellanyl-5-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 171800016 |
| Molecular Formula | C11H22N2Te |
| Molecular Weight | 309.91 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-methyltellanyl-5-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine |
| SMILES | C[Te]N1CC2CCN(C(C)C)CC2C1 |
| InChI | InChI=1S/C11H22N2Te/c1-9(2)12-5-4-10-7-13(14-3)8-11(10)6-12/h9-11H,4-8H2,1-3H3 |
| InChIKey | NEXNZHXXZKUTBR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.91 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|