C17H16N4O — CID 166010085
3-azido-1-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-one (PubChem CID 166010085) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-azido-1-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-one.
| Compound Name | 3-azido-1-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-one |
|---|---|
| PubChem CID | 166010085 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-azido-1-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-one |
| SMILES | [N-]=[N+]=NCCC(=O)N1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C17H16N4O/c18-20-19-12-11-17(22)21-15-7-3-1-5-13(15)9-10-14-6-2-4-8-16(14)21/h1-8H,9-12H2 |
| InChIKey | OXCKBYYGFUANIO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|