About (E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine
(E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine (PubChem CID 12023374) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is (E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine.
Molecular Properties
| Compound Name | (E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine |
| PubChem CID | 12023374 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine |
| SMILES | C/C=N/N1CCCc2ccccc21 |
| InChI | InChI=1S/C11H14N2/c1-2-12-13-9-5-7-10-6-3-4-8-11(10)13/h2-4,6,8H,5,7,9H2,1H3/b12-2+ |
| InChIKey | DQUPRVUWYAXGBN-SWGQDTFXSA-N |
| XLogP | 2.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine?
The IUPAC name of (E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine (CID 12023374) is (E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine.
What is the SMILES notation for (E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine?
The canonical SMILES for (E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine is C/C=N/N1CCCc2ccccc21.
What is the InChIKey of (E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine?
The InChIKey is DQUPRVUWYAXGBN-SWGQDTFXSA-N. The full InChI is InChI=1S/C11H14N2/c1-2-12-13-9-5-7-10-6-3-4-8-11(10)13/h2-4,6,8H,5,7,9H2,1H3/b12-2+.
What are the key properties of (E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine?
(E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine has a molecular weight of 174.25 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(3,4-dihydro-2H-quinolin-1-yl)ethanimine is sourced from PubChem (CID 12023374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).