C18H26N2 — CID 21135886
1-[1-[(E)-but-2-enyl]piperidin-4-yl]-3,4-dihydro-2H-quinoline (PubChem CID 21135886) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-[1-[(E)-but-2-enyl]piperidin-4-yl]-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[1-[(E)-but-2-enyl]piperidin-4-yl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 21135886 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 1-[1-[(E)-but-2-enyl]piperidin-4-yl]-3,4-dihydro-2H-quinoline |
| SMILES | C/C=C/CN1CCC(N2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C18H26N2/c1-2-3-12-19-14-10-17(11-15-19)20-13-6-8-16-7-4-5-9-18(16)20/h2-5,7,9,17H,6,8,10-15H2,1H3/b3-2+ |
| InChIKey | MTBGWHNTBPLJTC-NSCUHMNNSA-N |
| XLogP | 3.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|