C22H30N2O — CID 174390999
anisole;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole (PubChem CID 174390999) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is anisole;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole.
| Compound Name | anisole;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 174390999 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | anisole;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole |
| SMILES | CCN1CCC(N2CCc3ccccc32)CC1.COc1ccccc1 |
| InChI | InChI=1S/C15H22N2.C7H8O/c1-2-16-10-8-14(9-11-16)17-12-7-13-5-3-4-6-15(13)17;1-8-7-5-3-2-4-6-7/h3-6,14H,2,7-12H2,1H3;2-6H,1H3 |
| InChIKey | YALFYESRKCPDOE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |