C23H28N2O3 — CID 22038018
1-[1-[3-(1,3-benzodioxol-5-yloxy)propyl]piperidin-4-yl]-2,3-dihydroindole (PubChem CID 22038018) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 1-[1-[3-(1,3-benzodioxol-5-yloxy)propyl]piperidin-4-yl]-2,3-dihydroindole.
| Compound Name | 1-[1-[3-(1,3-benzodioxol-5-yloxy)propyl]piperidin-4-yl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 22038018 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 1-[1-[3-(1,3-benzodioxol-5-yloxy)propyl]piperidin-4-yl]-2,3-dihydroindole |
| SMILES | c1ccc2c(c1)CCN2C1CCN(CCCOc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C23H28N2O3/c1-2-5-21-18(4-1)8-14-25(21)19-9-12-24(13-10-19)11-3-15-26-20-6-7-22-23(16-20)28-17-27-22/h1-2,4-7,16,19H,3,8-15,17H2 |
| InChIKey | CXPJYEUREMVRRR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|