C22H31NO2 — CID 174661948
anisole;1-ethyl-4-(2-phenoxyethyl)piperidine (PubChem CID 174661948) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is anisole;1-ethyl-4-(2-phenoxyethyl)piperidine.
| Compound Name | anisole;1-ethyl-4-(2-phenoxyethyl)piperidine |
|---|---|
| PubChem CID | 174661948 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | anisole;1-ethyl-4-(2-phenoxyethyl)piperidine |
| SMILES | CCN1CCC(CCOc2ccccc2)CC1.COc1ccccc1 |
| InChI | InChI=1S/C15H23NO.C7H8O/c1-2-16-11-8-14(9-12-16)10-13-17-15-6-4-3-5-7-15;1-8-7-5-3-2-4-6-7/h3-7,14H,2,8-13H2,1H3;2-6H,1H3 |
| InChIKey | FRUIXSBVXQDDRL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |