C17H17N3 — CID 123789337
2,3-dihydroindol-1-yl-[(4-ethenylphenyl)methyl]diazene (PubChem CID 123789337) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-[(4-ethenylphenyl)methyl]diazene.
| Compound Name | 2,3-dihydroindol-1-yl-[(4-ethenylphenyl)methyl]diazene |
|---|---|
| PubChem CID | 123789337 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2,3-dihydroindol-1-yl-[(4-ethenylphenyl)methyl]diazene |
| SMILES | C=Cc1ccc(C/N=N/N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H17N3/c1-2-14-7-9-15(10-8-14)13-18-19-20-12-11-16-5-3-4-6-17(16)20/h2-10H,1,11-13H2/b19-18+ |
| InChIKey | QKFWTTVNBDJUAT-VHEBQXMUSA-N |
| XLogP | 4.26 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|