C8H11NSi — CID 149251229
2,3-dihydroindol-1-ylsilane (PubChem CID 149251229) has the molecular formula C8H11NSi and a molecular weight of 149.27 g/mol. Its IUPAC name is 2,3-dihydroindol-1-ylsilane.
| Compound Name | 2,3-dihydroindol-1-ylsilane |
|---|---|
| PubChem CID | 149251229 |
| Molecular Formula | C8H11NSi |
| Molecular Weight | 149.27 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 2,3-dihydroindol-1-ylsilane |
| SMILES | [SiH3]N1CCc2ccccc21 |
| InChI | InChI=1S/C8H11NSi/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4H,5-6H2,10H3 |
| InChIKey | MPJJFTDHGJBGKE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|