C13H15NO — CID 102451637
(3R)-3-(2,3-dihydroindol-1-yl)cyclopentan-1-one (PubChem CID 102451637) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is (3R)-3-(2,3-dihydroindol-1-yl)cyclopentan-1-one.
| Compound Name | (3R)-3-(2,3-dihydroindol-1-yl)cyclopentan-1-one |
|---|---|
| PubChem CID | 102451637 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (3R)-3-(2,3-dihydroindol-1-yl)cyclopentan-1-one |
| SMILES | O=C1CC[C@@H](N2CCc3ccccc32)C1 |
| InChI | InChI=1S/C13H15NO/c15-12-6-5-11(9-12)14-8-7-10-3-1-2-4-13(10)14/h1-4,11H,5-9H2/t11-/m1/s1 |
| InChIKey | PHYCCEGRVAIGGE-LLVKDONJSA-N |
| XLogP | 2.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |