C9H16O — CID 147800064
(1R)-2-methyl-1-prop-2-enylcyclopentan-1-ol (PubChem CID 147800064) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is (1R)-2-methyl-1-prop-2-enylcyclopentan-1-ol.
| Compound Name | (1R)-2-methyl-1-prop-2-enylcyclopentan-1-ol |
|---|---|
| PubChem CID | 147800064 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (1R)-2-methyl-1-prop-2-enylcyclopentan-1-ol |
| SMILES | C=CC[C@]1(O)CCCC1C |
| InChI | InChI=1S/C9H16O/c1-3-6-9(10)7-4-5-8(9)2/h3,8,10H,1,4-7H2,2H3/t8?,9-/m0/s1 |
| InChIKey | HLIRWNMOSGOEGE-GKAPJAKFSA-N |
| XLogP | 2.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|