C10H16O2 — CID 68881461
2-methyl-1-prop-2-enylcyclopentane-1-carboxylic acid (PubChem CID 68881461) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-methyl-1-prop-2-enylcyclopentane-1-carboxylic acid.
| Compound Name | 2-methyl-1-prop-2-enylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 68881461 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-methyl-1-prop-2-enylcyclopentane-1-carboxylic acid |
| SMILES | C=CCC1(C(=O)O)CCCC1C |
| InChI | InChI=1S/C10H16O2/c1-3-6-10(9(11)12)7-4-5-8(10)2/h3,8H,1,4-7H2,2H3,(H,11,12) |
| InChIKey | MXCLTZSYFUCKEJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|