C14H24O5 — CID 159439437
1-(2-methoxyethyl)cyclohexane-1,2-dicarboxylic acid;prop-1-ene (PubChem CID 159439437) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is 1-(2-methoxyethyl)cyclohexane-1,2-dicarboxylic acid;prop-1-ene.
| Compound Name | 1-(2-methoxyethyl)cyclohexane-1,2-dicarboxylic acid;prop-1-ene |
|---|---|
| PubChem CID | 159439437 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1-(2-methoxyethyl)cyclohexane-1,2-dicarboxylic acid;prop-1-ene |
| SMILES | C=CC.COCCC1(C(=O)O)CCCCC1C(=O)O |
| InChI | InChI=1S/C11H18O5.C3H6/c1-16-7-6-11(10(14)15)5-3-2-4-8(11)9(12)13;1-3-2/h8H,2-7H2,1H3,(H,12,13)(H,14,15);3H,1H2,2H3 |
| InChIKey | LRZHYNKOVNBSAW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|