C15H22O7 — CID 151301649
1-(4-ethenoxybutoxycarbonyl)cyclohexane-1,2-dicarboxylic acid (PubChem CID 151301649) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is 1-(4-ethenoxybutoxycarbonyl)cyclohexane-1,2-dicarboxylic acid.
| Compound Name | 1-(4-ethenoxybutoxycarbonyl)cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 151301649 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-(4-ethenoxybutoxycarbonyl)cyclohexane-1,2-dicarboxylic acid |
| SMILES | C=COCCCCOC(=O)C1(C(=O)O)CCCCC1C(=O)O |
| InChI | InChI=1S/C15H22O7/c1-2-21-9-5-6-10-22-14(20)15(13(18)19)8-4-3-7-11(15)12(16)17/h2,11H,1,3-10H2,(H,16,17)(H,18,19) |
| InChIKey | OCNWKAZOWNSYRF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|