C13H22O3 — CID 19881487
1-(4-ethenoxybutyl)cyclohexane-1-carboxylic acid (PubChem CID 19881487) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-(4-ethenoxybutyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(4-ethenoxybutyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 19881487 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 1-(4-ethenoxybutyl)cyclohexane-1-carboxylic acid |
| SMILES | C=COCCCCC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C13H22O3/c1-2-16-11-7-6-10-13(12(14)15)8-4-3-5-9-13/h2H,1,3-11H2,(H,14,15) |
| InChIKey | GRHSLHRBCMAVQE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|