1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid

C11H14O5 — CID 67543785

IUPAC1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid
SMILESC=CC(=O)C1(C(=O)O)CCCCC1C(=O)O
InChIInChI=1S/C11H14O5/c1-2-8(12)11(10(15)16)6-4-3-5-7(11)9(13)14/h2,7H,1,3-6H2,(H,13,14)(H,15,16)
InChIKeyUSRZLGSGQSATRC-UHFFFAOYSA-N
MW226.23 g/mol
LogP1.09
Rot. Bonds4

About 1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid

1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid (PubChem CID 67543785) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid.

Molecular Properties

Compound Name1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid
PubChem CID67543785
Molecular FormulaC11H14O5
Molecular Weight226.23 g/mol
Exact Mass226.08
IUPAC Name1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid
SMILESC=CC(=O)C1(C(=O)O)CCCCC1C(=O)O
InChIInChI=1S/C11H14O5/c1-2-8(12)11(10(15)16)6-4-3-5-7(11)9(13)14/h2,7H,1,3-6H2,(H,13,14)(H,15,16)
InChIKeyUSRZLGSGQSATRC-UHFFFAOYSA-N
XLogP1.09
TPSA91.67 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.23
LogP ≤ 51.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid?
The IUPAC name of 1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid (CID 67543785) is 1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid.
What is the SMILES notation for 1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid?
The canonical SMILES for 1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid is C=CC(=O)C1(C(=O)O)CCCCC1C(=O)O.
What is the InChIKey of 1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid?
The InChIKey is USRZLGSGQSATRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O5/c1-2-8(12)11(10(15)16)6-4-3-5-7(11)9(13)14/h2,7H,1,3-6H2,(H,13,14)(H,15,16).
What are the key properties of 1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid?
1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid has a molecular weight of 226.23 g/mol, XLogP of 1.09, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enoylcyclohexane-1,2-dicarboxylic acid is sourced from PubChem (CID 67543785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).