About cyclohexyl 5-ethenoxypentanoate
cyclohexyl 5-ethenoxypentanoate (PubChem CID 57037035) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is cyclohexyl 5-ethenoxypentanoate.
Molecular Properties
| Compound Name | cyclohexyl 5-ethenoxypentanoate |
| PubChem CID | 57037035 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | cyclohexyl 5-ethenoxypentanoate |
| SMILES | C=COCCCCC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C13H22O3/c1-2-15-11-7-6-10-13(14)16-12-8-4-3-5-9-12/h2,12H,1,3-11H2 |
| InChIKey | AYUZTAXFBCLZIU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 5-ethenoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 5-ethenoxypentanoate?
The IUPAC name of cyclohexyl 5-ethenoxypentanoate (CID 57037035) is cyclohexyl 5-ethenoxypentanoate.
What is the SMILES notation for cyclohexyl 5-ethenoxypentanoate?
The canonical SMILES for cyclohexyl 5-ethenoxypentanoate is C=COCCCCC(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl 5-ethenoxypentanoate?
The InChIKey is AYUZTAXFBCLZIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3/c1-2-15-11-7-6-10-13(14)16-12-8-4-3-5-9-12/h2,12H,1,3-11H2.
What are the key properties of cyclohexyl 5-ethenoxypentanoate?
cyclohexyl 5-ethenoxypentanoate has a molecular weight of 226.32 g/mol, XLogP of 3.19, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 5-ethenoxypentanoate is sourced from PubChem (CID 57037035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).