C12H20O5 — CID 90859114
1-(4-hydroxybutyl)cyclohexane-1,2-dicarboxylic acid (PubChem CID 90859114) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 1-(4-hydroxybutyl)cyclohexane-1,2-dicarboxylic acid.
| Compound Name | 1-(4-hydroxybutyl)cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 90859114 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-(4-hydroxybutyl)cyclohexane-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1CCCCC1(CCCCO)C(=O)O |
| InChI | InChI=1S/C12H20O5/c13-8-4-3-7-12(11(16)17)6-2-1-5-9(12)10(14)15/h9,13H,1-8H2,(H,14,15)(H,16,17) |
| InChIKey | AVTNPFKTLXZNOW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|