C20H30O9 — CID 160742310
2-hydroxybutyl prop-2-enoate;1-(2-prop-2-enoyloxyethyl)cyclohexane-1,2-dicarboxylic acid (PubChem CID 160742310) has the molecular formula C20H30O9 and a molecular weight of 414.45 g/mol. Its IUPAC name is 2-hydroxybutyl prop-2-enoate;1-(2-prop-2-enoyloxyethyl)cyclohexane-1,2-dicarboxylic acid.
| Compound Name | 2-hydroxybutyl prop-2-enoate;1-(2-prop-2-enoyloxyethyl)cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 160742310 |
| Molecular Formula | C20H30O9 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-hydroxybutyl prop-2-enoate;1-(2-prop-2-enoyloxyethyl)cyclohexane-1,2-dicarboxylic acid |
| SMILES | C=CC(=O)OCC(O)CC.C=CC(=O)OCCC1(C(=O)O)CCCCC1C(=O)O |
| InChI | InChI=1S/C13H18O6.C7H12O3/c1-2-10(14)19-8-7-13(12(17)18)6-4-3-5-9(13)11(15)16;1-3-6(8)5-10-7(9)4-2/h2,9H,1,3-8H2,(H,15,16)(H,17,18);4,6,8H,2-3,5H2,1H3 |
| InChIKey | RVSZLUBZEQHTCH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|