About trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid
trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 175835698) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid |
| PubChem CID | 175835698 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid |
| SMILES | CCC(C)COC(=O)[C@]1(C)CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C14H24O4/c1-4-10(2)9-18-13(17)14(3)8-6-5-7-11(14)12(15)16/h10-11H,4-9H2,1-3H3,(H,15,16)/t10?,11-,14+/m0/s1 |
| InChIKey | IEHHQHRASMETJT-SAQKRVJRSA-N |
| XLogP | 2.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid?
The IUPAC name of trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid (CID 175835698) is trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid?
The canonical SMILES for trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid is CCC(C)COC(=O)[C@]1(C)CCCC[C@H]1C(=O)O.
What is the InChIKey of trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid?
The InChIKey is IEHHQHRASMETJT-SAQKRVJRSA-N. The full InChI is InChI=1S/C14H24O4/c1-4-10(2)9-18-13(17)14(3)8-6-5-7-11(14)12(15)16/h10-11H,4-9H2,1-3H3,(H,15,16)/t10?,11-,14+/m0/s1.
What are the key properties of trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid?
trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid has a molecular weight of 256.34 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-methyl-2-(2-methylbutoxycarbonyl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 175835698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).