C13H30O4 — CID 173225702
methane;1-methylcyclohexane-1,2-dicarboxylic acid (PubChem CID 173225702) has the molecular formula C13H30O4 and a molecular weight of 250.38 g/mol. Its IUPAC name is methane;1-methylcyclohexane-1,2-dicarboxylic acid.
| Compound Name | methane;1-methylcyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 173225702 |
| Molecular Formula | C13H30O4 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | methane;1-methylcyclohexane-1,2-dicarboxylic acid |
| SMILES | C.C.C.C.CC1(C(=O)O)CCCCC1C(=O)O |
| InChI | InChI=1S/C9H14O4.4CH4/c1-9(8(12)13)5-3-2-4-6(9)7(10)11;;;;/h6H,2-5H2,1H3,(H,10,11)(H,12,13);4*1H4 |
| InChIKey | REVPZMDZVIFIAY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |