C9H15ClO4 — CID 159985709
1-methylcyclohexane-1,2-dicarboxylic acid;hydrochloride (PubChem CID 159985709) has the molecular formula C9H15ClO4 and a molecular weight of 222.67 g/mol. Its IUPAC name is 1-methylcyclohexane-1,2-dicarboxylic acid;hydrochloride.
| Compound Name | 1-methylcyclohexane-1,2-dicarboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 159985709 |
| Molecular Formula | C9H15ClO4 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 1-methylcyclohexane-1,2-dicarboxylic acid;hydrochloride |
| SMILES | CC1(C(=O)O)CCCCC1C(=O)O.Cl |
| InChI | InChI=1S/C9H14O4.ClH/c1-9(8(12)13)5-3-2-4-6(9)7(10)11;/h6H,2-5H2,1H3,(H,10,11)(H,12,13);1H |
| InChIKey | OGHSDTXMMKFRKD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |