C15H18O3 — CID 13054540
2-benzoyl-2-methylcyclohexane-1-carboxylic acid (PubChem CID 13054540) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-benzoyl-2-methylcyclohexane-1-carboxylic acid.
| Compound Name | 2-benzoyl-2-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 13054540 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-benzoyl-2-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1(C(=O)c2ccccc2)CCCCC1C(=O)O |
| InChI | InChI=1S/C15H18O3/c1-15(10-6-5-9-12(15)14(17)18)13(16)11-7-3-2-4-8-11/h2-4,7-8,12H,5-6,9-10H2,1H3,(H,17,18) |
| InChIKey | LMOOVUCOWNJPQS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |