C17H35NO2 — CID 142544115
but-1-ene;1-[(E)-3-methoxyprop-2-enyl]-2-methylcyclohexan-1-ol;N-methylmethanamine (PubChem CID 142544115) has the molecular formula C17H35NO2 and a molecular weight of 285.47 g/mol. Its IUPAC name is but-1-ene;1-[(E)-3-methoxyprop-2-enyl]-2-methylcyclohexan-1-ol;N-methylmethanamine.
| Compound Name | but-1-ene;1-[(E)-3-methoxyprop-2-enyl]-2-methylcyclohexan-1-ol;N-methylmethanamine |
|---|---|
| PubChem CID | 142544115 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | but-1-ene;1-[(E)-3-methoxyprop-2-enyl]-2-methylcyclohexan-1-ol;N-methylmethanamine |
| SMILES | C=CCC.CNC.CO/C=C/CC1(O)CCCCC1C |
| InChI | InChI=1S/C11H20O2.C4H8.C2H7N/c1-10-6-3-4-7-11(10,12)8-5-9-13-2;1-3-4-2;1-3-2/h5,9-10,12H,3-4,6-8H2,1-2H3;3H,1,4H2,2H3;3H,1-2H3/b9-5+;; |
| InChIKey | AFRRSBXVIPTIKQ-KJDUPKRESA-N |
| XLogP | 3.90 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|