C13H25O4P — CID 23420153
trans-(1S,2R)-2-diethoxyphosphoryl-1-prop-2-enylcyclohexan-1-ol (PubChem CID 23420153) has the molecular formula C13H25O4P and a molecular weight of 276.31 g/mol. Its IUPAC name is trans-(1S,2R)-2-diethoxyphosphoryl-1-prop-2-enylcyclohexan-1-ol.
| Compound Name | trans-(1S,2R)-2-diethoxyphosphoryl-1-prop-2-enylcyclohexan-1-ol |
|---|---|
| PubChem CID | 23420153 |
| Molecular Formula | C13H25O4P |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | trans-(1S,2R)-2-diethoxyphosphoryl-1-prop-2-enylcyclohexan-1-ol |
| SMILES | C=CC[C@@]1(O)CCCC[C@H]1P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H25O4P/c1-4-10-13(14)11-8-7-9-12(13)18(15,16-5-2)17-6-3/h4,12,14H,1,5-11H2,2-3H3/t12-,13-/m1/s1 |
| InChIKey | AOMQAYCNXUTDRS-CHWSQXEVSA-N |
| XLogP | 3.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|