C12H23O5P — CID 23420164
1-[(1R,2R)-2-diethoxyphosphoryl-1-hydroxycyclopentyl]propan-2-one (PubChem CID 23420164) has the molecular formula C12H23O5P and a molecular weight of 278.28 g/mol. Its IUPAC name is 1-[(1R,2R)-2-diethoxyphosphoryl-1-hydroxycyclopentyl]propan-2-one.
| Compound Name | 1-[(1R,2R)-2-diethoxyphosphoryl-1-hydroxycyclopentyl]propan-2-one |
|---|---|
| PubChem CID | 23420164 |
| Molecular Formula | C12H23O5P |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-[(1R,2R)-2-diethoxyphosphoryl-1-hydroxycyclopentyl]propan-2-one |
| SMILES | CCOP(=O)(OCC)[C@@H]1CCC[C@@]1(O)CC(C)=O |
| InChI | InChI=1S/C12H23O5P/c1-4-16-18(15,17-5-2)11-7-6-8-12(11,14)9-10(3)13/h11,14H,4-9H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | BASMRLZZEJQVMA-VXGBXAGGSA-N |
| XLogP | 2.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|