C21H30N2O3 — CID 178185675
tert-butyl (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-hydroxy-4-prop-2-enylpiperidine-1-carboxylate (PubChem CID 178185675) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-hydroxy-4-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-hydroxy-4-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 178185675 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | tert-butyl (3S,4R)-3-(2,3-dihydroindol-1-yl)-4-hydroxy-4-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CC[C@@]1(O)CCN(C(=O)OC(C)(C)C)C[C@@H]1N1CCc2ccccc21 |
| InChI | InChI=1S/C21H30N2O3/c1-5-11-21(25)12-14-22(19(24)26-20(2,3)4)15-18(21)23-13-10-16-8-6-7-9-17(16)23/h5-9,18,25H,1,10-15H2,2-4H3/t18-,21+/m0/s1 |
| InChIKey | YINHMRNLBKPFSB-GHTZIAJQSA-N |
| XLogP | 3.37 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|