C15H25NO3 — CID 176829864
tert-butyl 4-formyl-3-methyl-4-prop-2-enylpiperidine-1-carboxylate (PubChem CID 176829864) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is tert-butyl 4-formyl-3-methyl-4-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-formyl-3-methyl-4-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 176829864 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | tert-butyl 4-formyl-3-methyl-4-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CCC1(C=O)CCN(C(=O)OC(C)(C)C)CC1C |
| InChI | InChI=1S/C15H25NO3/c1-6-7-15(11-17)8-9-16(10-12(15)2)13(18)19-14(3,4)5/h6,11-12H,1,7-10H2,2-5H3 |
| InChIKey | AHGLWYCSKBHJJE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|