C13H13N — CID 145126142
1-penta-1,2,4-trien-3-yl-2,3-dihydroindole (PubChem CID 145126142) has the molecular formula C13H13N and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-penta-1,2,4-trien-3-yl-2,3-dihydroindole.
| Compound Name | 1-penta-1,2,4-trien-3-yl-2,3-dihydroindole |
|---|---|
| PubChem CID | 145126142 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 1-penta-1,2,4-trien-3-yl-2,3-dihydroindole |
| SMILES | C=C=C(C=C)N1CCc2ccccc21 |
| InChI | InChI=1S/C13H13N/c1-3-12(4-2)14-10-9-11-7-5-6-8-13(11)14/h3,5-8H,1-2,9-10H2 |
| InChIKey | UMPMOGYXHINKMU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|