C24H20N2O — CID 2442392
4-(2,3-dihydroindol-1-yl)-4-oxo-2,2-diphenylbutanenitrile (PubChem CID 2442392) has the molecular formula C24H20N2O and a molecular weight of 352.44 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-yl)-4-oxo-2,2-diphenylbutanenitrile.
| Compound Name | 4-(2,3-dihydroindol-1-yl)-4-oxo-2,2-diphenylbutanenitrile |
|---|---|
| PubChem CID | 2442392 |
| Molecular Formula | C24H20N2O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 4-(2,3-dihydroindol-1-yl)-4-oxo-2,2-diphenylbutanenitrile |
| SMILES | N#CC(CC(=O)N1CCc2ccccc21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O/c25-18-24(20-10-3-1-4-11-20,21-12-5-2-6-13-21)17-23(27)26-16-15-19-9-7-8-14-22(19)26/h1-14H,15-17H2 |
| InChIKey | TZLXMLRHLZCCHT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |