C18H22O2 — CID 155676403
3-hydroxy-5-phenyl-2,2-bis(prop-2-enyl)cyclohexan-1-one (PubChem CID 155676403) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 3-hydroxy-5-phenyl-2,2-bis(prop-2-enyl)cyclohexan-1-one.
| Compound Name | 3-hydroxy-5-phenyl-2,2-bis(prop-2-enyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 155676403 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 3-hydroxy-5-phenyl-2,2-bis(prop-2-enyl)cyclohexan-1-one |
| SMILES | C=CCC1(CC=C)C(=O)CC(c2ccccc2)CC1O |
| InChI | InChI=1S/C18H22O2/c1-3-10-18(11-4-2)16(19)12-15(13-17(18)20)14-8-6-5-7-9-14/h3-9,15-16,19H,1-2,10-13H2 |
| InChIKey | ULKJEZMAXXVIRZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|