C20H19BrO2 — CID 134940869
cis-(2R,4S)-4-(4-bromophenyl)-2-ethenyl-2-phenylmethoxycyclopentan-1-one (PubChem CID 134940869) has the molecular formula C20H19BrO2 and a molecular weight of 371.27 g/mol. Its IUPAC name is cis-(2R,4S)-4-(4-bromophenyl)-2-ethenyl-2-phenylmethoxycyclopentan-1-one.
| Compound Name | cis-(2R,4S)-4-(4-bromophenyl)-2-ethenyl-2-phenylmethoxycyclopentan-1-one |
|---|---|
| PubChem CID | 134940869 |
| Molecular Formula | C20H19BrO2 |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | cis-(2R,4S)-4-(4-bromophenyl)-2-ethenyl-2-phenylmethoxycyclopentan-1-one |
| SMILES | C=C[C@]1(OCc2ccccc2)C[C@H](c2ccc(Br)cc2)CC1=O |
| InChI | InChI=1S/C20H19BrO2/c1-2-20(23-14-15-6-4-3-5-7-15)13-17(12-19(20)22)16-8-10-18(21)11-9-16/h2-11,17H,1,12-14H2/t17-,20+/m1/s1 |
| InChIKey | BHKHMQADZZBSON-XLIONFOSSA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|