C26H38O4 — CID 157209880
(5R)-3-hydroxy-5-methyl-2,2-bis(prop-2-enyl)cyclohexan-1-one;5-methyl-2,2-bis(prop-2-enyl)cyclohexane-1,3-dione (PubChem CID 157209880) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is (5R)-3-hydroxy-5-methyl-2,2-bis(prop-2-enyl)cyclohexan-1-one;5-methyl-2,2-bis(prop-2-enyl)cyclohexane-1,3-dione.
| Compound Name | (5R)-3-hydroxy-5-methyl-2,2-bis(prop-2-enyl)cyclohexan-1-one;5-methyl-2,2-bis(prop-2-enyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 157209880 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | (5R)-3-hydroxy-5-methyl-2,2-bis(prop-2-enyl)cyclohexan-1-one;5-methyl-2,2-bis(prop-2-enyl)cyclohexane-1,3-dione |
| SMILES | C=CCC1(CC=C)C(=O)CC(C)CC1=O.C=CCC1(CC=C)C(=O)C[C@H](C)CC1O |
| InChI | InChI=1S/C13H20O2.C13H18O2/c2*1-4-6-13(7-5-2)11(14)8-10(3)9-12(13)15/h4-5,10-11,14H,1-2,6-9H2,3H3;4-5,10H,1-2,6-9H2,3H3/t10-,11?;/m1./s1 |
| InChIKey | ARTQRURKPKTBGN-QUUNXCOLSA-N |
| XLogP | 5.18 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|