C10H16O2 — CID 10725788
trans-(2S,3R)-3-hydroxy-2-methyl-2-prop-2-enylcyclohexan-1-one (PubChem CID 10725788) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is trans-(2S,3R)-3-hydroxy-2-methyl-2-prop-2-enylcyclohexan-1-one.
| Compound Name | trans-(2S,3R)-3-hydroxy-2-methyl-2-prop-2-enylcyclohexan-1-one |
|---|---|
| PubChem CID | 10725788 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | trans-(2S,3R)-3-hydroxy-2-methyl-2-prop-2-enylcyclohexan-1-one |
| SMILES | C=CC[C@]1(C)C(=O)CCC[C@H]1O |
| InChI | InChI=1S/C10H16O2/c1-3-7-10(2)8(11)5-4-6-9(10)12/h3,8,11H,1,4-7H2,2H3/t8-,10+/m1/s1 |
| InChIKey | DSGQUBLTBNJBLZ-SCZZXKLOSA-N |
| XLogP | 1.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|