C10H18O2 — CID 86182604
3-hydroxy-2,2-dimethylcyclooctan-1-one (PubChem CID 86182604) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethylcyclooctan-1-one.
| Compound Name | 3-hydroxy-2,2-dimethylcyclooctan-1-one |
|---|---|
| PubChem CID | 86182604 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 3-hydroxy-2,2-dimethylcyclooctan-1-one |
| SMILES | CC1(C)C(=O)CCCCCC1O |
| InChI | InChI=1S/C10H18O2/c1-10(2)8(11)6-4-3-5-7-9(10)12/h8,11H,3-7H2,1-2H3 |
| InChIKey | DGCGAGUYDHLTST-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |